C11H22N2O14S2 — CID 23212052
propane-1,2-diamine;bis(2-sulfobutanedioic acid) (PubChem CID 23212052) has the molecular formula C11H22N2O14S2 and a molecular weight of 470.43 g/mol. Its IUPAC name is propane-1,2-diamine;bis(2-sulfobutanedioic acid).
| Compound Name | propane-1,2-diamine;bis(2-sulfobutanedioic acid) |
|---|---|
| PubChem CID | 23212052 |
| Molecular Formula | C11H22N2O14S2 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | propane-1,2-diamine;bis(2-sulfobutanedioic acid) |
| SMILES | CC(N)CN.O=C(O)CC(C(=O)O)S(=O)(=O)O.O=C(O)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/2C4H6O7S.C3H10N2/c2*5-3(6)1-2(4(7)8)12(9,10)11;1-3(5)2-4/h2*2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);3H,2,4-5H2,1H3 |
| InChIKey | WCFQAXIQSFRELL-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 309.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|