C9H20NO8S+ — CID 135221506
2-hydroxyethyl(trimethyl)azanium;2-sulfobutanedioic acid (PubChem CID 135221506) has the molecular formula C9H20NO8S+ and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;2-sulfobutanedioic acid.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 135221506 |
| Molecular Formula | C9H20NO8S+ |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2-sulfobutanedioic acid |
| SMILES | C[N+](C)(C)CCO.O=C(O)CC(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H14NO.C4H6O7S/c1-6(2,3)4-5-7;5-3(6)1-2(4(7)8)12(9,10)11/h7H,4-5H2,1-3H3;2H,1H2,(H,5,6)(H,7,8)(H,9,10,11)/q+1; |
| InChIKey | QRVDLEKSNJBIGD-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|