C9H23N2O5S+ — CID 174545267
1-amino-1-oxobutane-2-sulfonic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 174545267) has the molecular formula C9H23N2O5S+ and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-amino-1-oxobutane-2-sulfonic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 1-amino-1-oxobutane-2-sulfonic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 174545267 |
| Molecular Formula | C9H23N2O5S+ |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-amino-1-oxobutane-2-sulfonic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CCC(C(N)=O)S(=O)(=O)O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C4H9NO4S/c1-6(2,3)4-5-7;1-2-3(4(5)6)10(7,8)9/h7H,4-5H2,1-3H3;3H,2H2,1H3,(H2,5,6)(H,7,8,9)/q+1; |
| InChIKey | DZJWCOFEKSDYGR-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|