C4H7KO7S — CID 173197982
potassium;hydride;2-sulfobutanedioic acid (PubChem CID 173197982) has the molecular formula C4H7KO7S and a molecular weight of 238.26 g/mol. Its IUPAC name is potassium;hydride;2-sulfobutanedioic acid.
| Compound Name | potassium;hydride;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 173197982 |
| Molecular Formula | C4H7KO7S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | potassium;hydride;2-sulfobutanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C4H6O7S.K.H/c5-3(6)1-2(4(7)8)12(9,10)11;;/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);;/q;+1;-1 |
| InChIKey | FIMDKMNWYJHZHM-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|