C7H7F2NaO7S — CID 88525828
sodium 4-(1,1-difluoroprop-2-enoxy)-4-oxo-3-sulfobutanoate (PubChem CID 88525828) has the molecular formula C7H7F2NaO7S and a molecular weight of 296.18 g/mol. Its IUPAC name is sodium 4-(1,1-difluoroprop-2-enoxy)-4-oxo-3-sulfobutanoate.
| Compound Name | sodium 4-(1,1-difluoroprop-2-enoxy)-4-oxo-3-sulfobutanoate |
|---|---|
| PubChem CID | 88525828 |
| Molecular Formula | C7H7F2NaO7S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | sodium 4-(1,1-difluoroprop-2-enoxy)-4-oxo-3-sulfobutanoate |
| SMILES | C=CC(F)(F)OC(=O)C(CC(=O)[O-])S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C7H8F2O7S.Na/c1-2-7(8,9)16-6(12)4(3-5(10)11)17(13,14)15;/h2,4H,1,3H2,(H,10,11)(H,13,14,15);/q;+1/p-1 |
| InChIKey | RNZTWVUCAAHILA-UHFFFAOYSA-M |
| XLogP | -4.29 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|