C8H12O7S-2 — CID 140594232
4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-sulfonatobutanoate (PubChem CID 140594232) has the molecular formula C8H12O7S-2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-sulfonatobutanoate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-sulfonatobutanoate |
|---|---|
| PubChem CID | 140594232 |
| Molecular Formula | C8H12O7S-2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-sulfonatobutanoate |
| SMILES | CC(C)(C)OC(=O)C(CC(=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/C8H14O7S/c1-8(2,3)15-7(11)5(4-6(9)10)16(12,13)14/h5H,4H2,1-3H3,(H,9,10)(H,12,13,14)/p-2 |
| InChIKey | LADVFDLTKNFLTC-UHFFFAOYSA-L |
| XLogP | -1.62 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|