C10H16O7S-2 — CID 58669244
6-butoxy-4-oxo-3-sulfonatohexanoate (PubChem CID 58669244) has the molecular formula C10H16O7S-2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 6-butoxy-4-oxo-3-sulfonatohexanoate.
| Compound Name | 6-butoxy-4-oxo-3-sulfonatohexanoate |
|---|---|
| PubChem CID | 58669244 |
| Molecular Formula | C10H16O7S-2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 6-butoxy-4-oxo-3-sulfonatohexanoate |
| SMILES | CCCCOCCC(=O)C(CC(=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H18O7S/c1-2-3-5-17-6-4-8(11)9(7-10(12)13)18(14,15)16/h9H,2-7H2,1H3,(H,12,13)(H,14,15,16)/p-2 |
| InChIKey | ISRMKEMKKYBFDC-UHFFFAOYSA-L |
| XLogP | -1.18 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|