About 11-butoxyundecanoate
11-butoxyundecanoate (PubChem CID 7614560) has the molecular formula C15H29O3-
and a molecular weight of 257.39 g/mol. Its IUPAC name is 11-butoxyundecanoate.
Molecular Properties
| Compound Name | 11-butoxyundecanoate |
| PubChem CID | 7614560 |
| Molecular Formula | C15H29O3- |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 11-butoxyundecanoate |
| SMILES | CCCCOCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C15H30O3/c1-2-3-13-18-14-11-9-7-5-4-6-8-10-12-15(16)17/h2-14H2,1H3,(H,16,17)/p-1 |
| InChIKey | GGLNIBSAZPKDDR-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-butoxyundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-butoxyundecanoate?
The IUPAC name of 11-butoxyundecanoate (CID 7614560) is 11-butoxyundecanoate.
What is the SMILES notation for 11-butoxyundecanoate?
The canonical SMILES for 11-butoxyundecanoate is CCCCOCCCCCCCCCCC(=O)[O-].
What is the InChIKey of 11-butoxyundecanoate?
The InChIKey is GGLNIBSAZPKDDR-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H30O3/c1-2-3-13-18-14-11-9-7-5-4-6-8-10-12-15(16)17/h2-14H2,1H3,(H,16,17)/p-1.
What are the key properties of 11-butoxyundecanoate?
11-butoxyundecanoate has a molecular weight of 257.39 g/mol, XLogP of 3.06, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-butoxyundecanoate is sourced from PubChem (CID 7614560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).