About potassium;2-(2-hydroxyethoxy)ethanol;octanoate
potassium;2-(2-hydroxyethoxy)ethanol;octanoate (PubChem CID 162260496) has the molecular formula C12H25KO5
and a molecular weight of 288.43 g/mol. Its IUPAC name is potassium;2-(2-hydroxyethoxy)ethanol;octanoate.
Molecular Properties
| Compound Name | potassium;2-(2-hydroxyethoxy)ethanol;octanoate |
| PubChem CID | 162260496 |
| Molecular Formula | C12H25KO5 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | potassium;2-(2-hydroxyethoxy)ethanol;octanoate |
| SMILES | CCCCCCCC(=O)[O-].OCCOCCO.[K+] |
| InChI | InChI=1S/C8H16O2.C4H10O3.K/c1-2-3-4-5-6-7-8(9)10;5-1-3-7-4-2-6;/h2-7H2,1H3,(H,9,10);5-6H,1-4H2;/q;;+1/p-1 |
| InChIKey | IDMVKVBJCAMVPG-UHFFFAOYSA-M |
| XLogP | -2.91 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-(2-hydroxyethoxy)ethanol;octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-(2-hydroxyethoxy)ethanol;octanoate?
The IUPAC name of potassium;2-(2-hydroxyethoxy)ethanol;octanoate (CID 162260496) is potassium;2-(2-hydroxyethoxy)ethanol;octanoate.
What is the SMILES notation for potassium;2-(2-hydroxyethoxy)ethanol;octanoate?
The canonical SMILES for potassium;2-(2-hydroxyethoxy)ethanol;octanoate is CCCCCCCC(=O)[O-].OCCOCCO.[K+].
What is the InChIKey of potassium;2-(2-hydroxyethoxy)ethanol;octanoate?
The InChIKey is IDMVKVBJCAMVPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.C4H10O3.K/c1-2-3-4-5-6-7-8(9)10;5-1-3-7-4-2-6;/h2-7H2,1H3,(H,9,10);5-6H,1-4H2;/q;;+1/p-1.
What are the key properties of potassium;2-(2-hydroxyethoxy)ethanol;octanoate?
potassium;2-(2-hydroxyethoxy)ethanol;octanoate has a molecular weight of 288.43 g/mol, XLogP of -2.91, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-(2-hydroxyethoxy)ethanol;octanoate is sourced from PubChem (CID 162260496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).