C9H14O7 — CID 87655481
[1-carboxyoxy-3-(2-methylprop-2-enoxy)propan-2-yl] hydrogen carbonate (PubChem CID 87655481) has the molecular formula C9H14O7 and a molecular weight of 234.20 g/mol. Its IUPAC name is [1-carboxyoxy-3-(2-methylprop-2-enoxy)propan-2-yl] hydrogen carbonate.
| Compound Name | [1-carboxyoxy-3-(2-methylprop-2-enoxy)propan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87655481 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [1-carboxyoxy-3-(2-methylprop-2-enoxy)propan-2-yl] hydrogen carbonate |
| SMILES | C=C(C)COCC(COC(=O)O)OC(=O)O |
| InChI | InChI=1S/C9H14O7/c1-6(2)3-14-4-7(16-9(12)13)5-15-8(10)11/h7H,1,3-5H2,2H3,(H,10,11)(H,12,13) |
| InChIKey | HNUYRCBVAOESRF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|