C14H20O6 — CID 88727868
[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoxypropan-2-yl] 3-oxobutanoate (PubChem CID 88727868) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is [1-(2-methylprop-2-enoyloxy)-3-prop-2-enoxypropan-2-yl] 3-oxobutanoate.
| Compound Name | [1-(2-methylprop-2-enoyloxy)-3-prop-2-enoxypropan-2-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 88727868 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [1-(2-methylprop-2-enoyloxy)-3-prop-2-enoxypropan-2-yl] 3-oxobutanoate |
| SMILES | C=CCOCC(COC(=O)C(=C)C)OC(=O)CC(C)=O |
| InChI | InChI=1S/C14H20O6/c1-5-6-18-8-12(9-19-14(17)10(2)3)20-13(16)7-11(4)15/h5,12H,1-2,6-9H2,3-4H3 |
| InChIKey | WSMMTVJWHFSVHR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|