C20H24O7 — CID 132609094
4-[1-[(4-ethenylphenyl)methoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 132609094) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[1-[(4-ethenylphenyl)methoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[1-[(4-ethenylphenyl)methoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 132609094 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[1-[(4-ethenylphenyl)methoxy]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | C=Cc1ccc(COCC(COC(=O)C(=C)C)OC(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H24O7/c1-4-15-5-7-16(8-6-15)11-25-12-17(13-26-20(24)14(2)3)27-19(23)10-9-18(21)22/h4-8,17H,1-2,9-13H2,3H3,(H,21,22) |
| InChIKey | GGPKQCGXFXMNNY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|