C11H10Br3F3O4S — CID 22760240
1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate (PubChem CID 22760240) has the molecular formula C11H10Br3F3O4S and a molecular weight of 534.97 g/mol. Its IUPAC name is 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate.
| Compound Name | 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22760240 |
| Molecular Formula | C11H10Br3F3O4S |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 531.78 |
| IUPAC Name | 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate |
| SMILES | CCC(COc1c(Br)cc(Br)cc1Br)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H10Br3F3O4S/c1-2-7(21-22(18,19)11(15,16)17)5-20-10-8(13)3-6(12)4-9(10)14/h3-4,7H,2,5H2,1H3 |
| InChIKey | LEGYBLBTKLXPEK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|