About 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate
1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate (PubChem CID 22760240) has the molecular formula C11H10Br3F3O4S
and a molecular weight of 534.97 g/mol. Its IUPAC name is 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate |
| PubChem CID | 22760240 |
| Molecular Formula | C11H10Br3F3O4S |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 531.78 |
| IUPAC Name | 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate |
| SMILES | CCC(COc1c(Br)cc(Br)cc1Br)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H10Br3F3O4S/c1-2-7(21-22(18,19)11(15,16)17)5-20-10-8(13)3-6(12)4-9(10)14/h3-4,7H,2,5H2,1H3 |
| InChIKey | LEGYBLBTKLXPEK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate?
The IUPAC name of 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate (CID 22760240) is 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate.
What is the SMILES notation for 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate?
The canonical SMILES for 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate is CCC(COc1c(Br)cc(Br)cc1Br)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate?
The InChIKey is LEGYBLBTKLXPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br3F3O4S/c1-2-7(21-22(18,19)11(15,16)17)5-20-10-8(13)3-6(12)4-9(10)14/h3-4,7H,2,5H2,1H3.
What are the key properties of 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate?
1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate has a molecular weight of 534.97 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,6-tribromophenoxy)butan-2-yl trifluoromethanesulfonate is sourced from PubChem (CID 22760240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).