C12H16Br3NO2 — CID 43166275
1-(propylamino)-3-(2,4,6-tribromophenoxy)propan-2-ol (PubChem CID 43166275) has the molecular formula C12H16Br3NO2 and a molecular weight of 445.98 g/mol. Its IUPAC name is 1-(propylamino)-3-(2,4,6-tribromophenoxy)propan-2-ol.
| Compound Name | 1-(propylamino)-3-(2,4,6-tribromophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 43166275 |
| Molecular Formula | C12H16Br3NO2 |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 442.87 |
| IUPAC Name | 1-(propylamino)-3-(2,4,6-tribromophenoxy)propan-2-ol |
| SMILES | CCCNCC(O)COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br3NO2/c1-2-3-16-6-9(17)7-18-12-10(14)4-8(13)5-11(12)15/h4-5,9,16-17H,2-3,6-7H2,1H3 |
| InChIKey | JQDOUEPDWNDFER-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|