C12H16Br3NO — CID 63500708
N-methyl-1-(2,4,6-tribromophenoxy)pentan-2-amine (PubChem CID 63500708) has the molecular formula C12H16Br3NO and a molecular weight of 429.98 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-tribromophenoxy)pentan-2-amine.
| Compound Name | N-methyl-1-(2,4,6-tribromophenoxy)pentan-2-amine |
|---|---|
| PubChem CID | 63500708 |
| Molecular Formula | C12H16Br3NO |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 426.88 |
| IUPAC Name | N-methyl-1-(2,4,6-tribromophenoxy)pentan-2-amine |
| SMILES | CCCC(COc1c(Br)cc(Br)cc1Br)NC |
| InChI | InChI=1S/C12H16Br3NO/c1-3-4-9(16-2)7-17-12-10(14)5-8(13)6-11(12)15/h5-6,9,16H,3-4,7H2,1-2H3 |
| InChIKey | ZVNXSIJFFLVTKE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |