C21H20Br8O2 — CID 20503938
1,5-dibromo-3-[2-[3,5-dibromo-2-(2,3-dibromopropoxy)phenyl]propan-2-yl]-2-(2,3-dibromopropoxy)benzene (PubChem CID 20503938) has the molecular formula C21H20Br8O2 and a molecular weight of 943.62 g/mol. Its IUPAC name is 1,5-dibromo-3-[2-[3,5-dibromo-2-(2,3-dibromopropoxy)phenyl]propan-2-yl]-2-(2,3-dibromopropoxy)benzene.
| Compound Name | 1,5-dibromo-3-[2-[3,5-dibromo-2-(2,3-dibromopropoxy)phenyl]propan-2-yl]-2-(2,3-dibromopropoxy)benzene |
|---|---|
| PubChem CID | 20503938 |
| Molecular Formula | C21H20Br8O2 |
| Molecular Weight | 943.62 g/mol |
| Exact Mass | 935.49 |
| IUPAC Name | 1,5-dibromo-3-[2-[3,5-dibromo-2-(2,3-dibromopropoxy)phenyl]propan-2-yl]-2-(2,3-dibromopropoxy)benzene |
| SMILES | CC(C)(c1cc(Br)cc(Br)c1OCC(Br)CBr)c1cc(Br)cc(Br)c1OCC(Br)CBr |
| InChI | InChI=1S/C21H20Br8O2/c1-21(2,15-3-11(24)5-17(28)19(15)30-9-13(26)7-22)16-4-12(25)6-18(29)20(16)31-10-14(27)8-23/h3-6,13-14H,7-10H2,1-2H3 |
| InChIKey | QIHYSUSBINZGSV-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.62 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|