C21H20Br8O2 — CID 87628869
1,3-dibromo-5-[1-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propyl]-2-(2,3-dibromopropoxy)benzene (PubChem CID 87628869) has the molecular formula C21H20Br8O2 and a molecular weight of 943.62 g/mol. Its IUPAC name is 1,3-dibromo-5-[1-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propyl]-2-(2,3-dibromopropoxy)benzene.
| Compound Name | 1,3-dibromo-5-[1-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propyl]-2-(2,3-dibromopropoxy)benzene |
|---|---|
| PubChem CID | 87628869 |
| Molecular Formula | C21H20Br8O2 |
| Molecular Weight | 943.62 g/mol |
| Exact Mass | 935.49 |
| IUPAC Name | 1,3-dibromo-5-[1-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propyl]-2-(2,3-dibromopropoxy)benzene |
| SMILES | CCC(c1cc(Br)c(OCC(Br)CBr)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1 |
| InChI | InChI=1S/C21H20Br8O2/c1-2-15(11-3-16(26)20(17(27)4-11)30-9-13(24)7-22)12-5-18(28)21(19(29)6-12)31-10-14(25)8-23/h3-6,13-15H,2,7-10H2,1H3 |
| InChIKey | UUGNZAOUQWLQSF-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.62 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|