C29H38Br6O4 — CID 139800300
1,3-dibromo-2-(3-bromo-2-butoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-butoxypropoxy)phenyl]propan-2-yl]benzene (PubChem CID 139800300) has the molecular formula C29H38Br6O4 and a molecular weight of 930.04 g/mol. Its IUPAC name is 1,3-dibromo-2-(3-bromo-2-butoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-butoxypropoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1,3-dibromo-2-(3-bromo-2-butoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-butoxypropoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139800300 |
| Molecular Formula | C29H38Br6O4 |
| Molecular Weight | 930.04 g/mol |
| Exact Mass | 923.79 |
| IUPAC Name | 1,3-dibromo-2-(3-bromo-2-butoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-butoxypropoxy)phenyl]propan-2-yl]benzene |
| SMILES | CCCCOC(CBr)COc1c(Br)cc(C(C)(C)c2cc(Br)c(OCC(CBr)OCCCC)c(Br)c2)cc1Br |
| InChI | InChI=1S/C29H38Br6O4/c1-5-7-9-36-21(15-30)17-38-27-23(32)11-19(12-24(27)33)29(3,4)20-13-25(34)28(26(35)14-20)39-18-22(16-31)37-10-8-6-2/h11-14,21-22H,5-10,15-18H2,1-4H3 |
| InChIKey | VNTCHTAQPGHDQB-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.04 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|