C27H30Br6O4 — CID 139784961
1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]propan-2-yl]benzene (PubChem CID 139784961) has the molecular formula C27H30Br6O4 and a molecular weight of 897.96 g/mol. Its IUPAC name is 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139784961 |
| Molecular Formula | C27H30Br6O4 |
| Molecular Weight | 897.96 g/mol |
| Exact Mass | 891.72 |
| IUPAC Name | 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[2-[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]propan-2-yl]benzene |
| SMILES | C=CCOC(CBr)COc1c(Br)cc(C(C)(C)c2cc(Br)c(OCC(CBr)OCC=C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C27H30Br6O4/c1-5-7-34-19(13-28)15-36-25-21(30)9-17(10-22(25)31)27(3,4)18-11-23(32)26(24(33)12-18)37-16-20(14-29)35-8-6-2/h5-6,9-12,19-20H,1-2,7-8,13-16H2,3-4H3 |
| InChIKey | NIXDZNQZGRSPHM-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.96 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|