C27H32Br4O2 — CID 59551592
1,3-dibromo-5-[2-(3,5-dibromo-4-hex-5-enoxyphenyl)propan-2-yl]-2-hex-5-enoxybenzene (PubChem CID 59551592) has the molecular formula C27H32Br4O2 and a molecular weight of 708.17 g/mol. Its IUPAC name is 1,3-dibromo-5-[2-(3,5-dibromo-4-hex-5-enoxyphenyl)propan-2-yl]-2-hex-5-enoxybenzene.
| Compound Name | 1,3-dibromo-5-[2-(3,5-dibromo-4-hex-5-enoxyphenyl)propan-2-yl]-2-hex-5-enoxybenzene |
|---|---|
| PubChem CID | 59551592 |
| Molecular Formula | C27H32Br4O2 |
| Molecular Weight | 708.17 g/mol |
| Exact Mass | 703.91 |
| IUPAC Name | 1,3-dibromo-5-[2-(3,5-dibromo-4-hex-5-enoxyphenyl)propan-2-yl]-2-hex-5-enoxybenzene |
| SMILES | C=CCCCCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCCCC=C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C27H32Br4O2/c1-5-7-9-11-13-32-25-21(28)15-19(16-22(25)29)27(3,4)20-17-23(30)26(24(31)18-20)33-14-12-10-8-6-2/h5-6,15-18H,1-2,7-14H2,3-4H3 |
| InChIKey | FILBXPQISVMMRO-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.17 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|