C25H34Br4N2O2 — CID 101327185
5-[4-[2-[4-(4-aminopentoxy)-3,5-dibromophenyl]propan-2-yl]-2,6-dibromophenoxy]pentan-2-amine (PubChem CID 101327185) has the molecular formula C25H34Br4N2O2 and a molecular weight of 714.17 g/mol. Its IUPAC name is 5-[4-[2-[4-(4-aminopentoxy)-3,5-dibromophenyl]propan-2-yl]-2,6-dibromophenoxy]pentan-2-amine.
| Compound Name | 5-[4-[2-[4-(4-aminopentoxy)-3,5-dibromophenyl]propan-2-yl]-2,6-dibromophenoxy]pentan-2-amine |
|---|---|
| PubChem CID | 101327185 |
| Molecular Formula | C25H34Br4N2O2 |
| Molecular Weight | 714.17 g/mol |
| Exact Mass | 709.94 |
| IUPAC Name | 5-[4-[2-[4-(4-aminopentoxy)-3,5-dibromophenyl]propan-2-yl]-2,6-dibromophenoxy]pentan-2-amine |
| SMILES | CC(N)CCCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCCC(C)N)c(Br)c2)cc1Br |
| InChI | InChI=1S/C25H34Br4N2O2/c1-15(30)7-5-9-32-23-19(26)11-17(12-20(23)27)25(3,4)18-13-21(28)24(22(29)14-18)33-10-6-8-16(2)31/h11-16H,5-10,30-31H2,1-4H3 |
| InChIKey | SARDFBQTXYSZCT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.17 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|