C32H42Br4O2Si3 — CID 59168485
CID 59168485 (PubChem CID 59168485) has the molecular formula C32H42Br4O2Si3 and a molecular weight of 862.56 g/mol.
| Compound Name | CID 59168485 |
|---|---|
| PubChem CID | 59168485 |
| Molecular Formula | C32H42Br4O2Si3 |
| Molecular Weight | 862.56 g/mol |
| Exact Mass | 857.92 |
| IUPAC Name | — |
| SMILES | CCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCC[Si](C)(C)c3cc([Si](C)C)cc([Si](C)C)c3)c(Br)c2)cc1Br |
| InChI | InChI=1S/C32H42Br4O2Si3/c1-10-37-30-26(33)14-21(15-27(30)34)32(2,3)22-16-28(35)31(29(36)17-22)38-12-11-13-41(8,9)25-19-23(39(4)5)18-24(20-25)40(6)7/h14-20H,10-13H2,1-9H3 |
| InChIKey | FXNMCCBBNQEFMD-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.56 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|