C33H44Br4O2Si3 — CID 58988381
CID 58988381 (PubChem CID 58988381) has the molecular formula C33H44Br4O2Si3 and a molecular weight of 876.59 g/mol.
| Compound Name | CID 58988381 |
|---|---|
| PubChem CID | 58988381 |
| Molecular Formula | C33H44Br4O2Si3 |
| Molecular Weight | 876.59 g/mol |
| Exact Mass | 871.94 |
| IUPAC Name | — |
| SMILES | CCCOc1c(Br)cc(C(C)(C)c2cc(Br)c(OCCC[Si](C)(C)c3cc([Si](C)C)cc([Si](C)C)c3)c(Br)c2)cc1Br |
| InChI | InChI=1S/C33H44Br4O2Si3/c1-10-12-38-31-27(34)15-22(16-28(31)35)33(2,3)23-17-29(36)32(30(37)18-23)39-13-11-14-42(8,9)26-20-24(40(4)5)19-25(21-26)41(6)7/h15-21H,10-14H2,1-9H3 |
| InChIKey | XXESWXDIOHGJGL-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.59 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|