C27H33Br7O3 — CID 139829098
1,3-dibromo-2-(3-bromo-2-octoxypropoxy)-5-[[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]methyl]benzene (PubChem CID 139829098) has the molecular formula C27H33Br7O3 and a molecular weight of 964.89 g/mol. Its IUPAC name is 1,3-dibromo-2-(3-bromo-2-octoxypropoxy)-5-[[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]methyl]benzene.
| Compound Name | 1,3-dibromo-2-(3-bromo-2-octoxypropoxy)-5-[[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 139829098 |
| Molecular Formula | C27H33Br7O3 |
| Molecular Weight | 964.89 g/mol |
| Exact Mass | 957.67 |
| IUPAC Name | 1,3-dibromo-2-(3-bromo-2-octoxypropoxy)-5-[[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]methyl]benzene |
| SMILES | CCCCCCCCOC(CBr)COc1c(Br)cc(Cc2cc(Br)c(OCC(Br)CBr)c(Br)c2)cc1Br |
| InChI | InChI=1S/C27H33Br7O3/c1-2-3-4-5-6-7-8-35-21(15-29)17-37-27-24(33)12-19(13-25(27)34)9-18-10-22(31)26(23(32)11-18)36-16-20(30)14-28/h10-13,20-21H,2-9,14-17H2,1H3 |
| InChIKey | UDMXFBYTWWJUHC-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.89 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|