C18H14Br8O2 — CID 22186312
1,3-dibromo-5-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]-2-(2,3-dibromopropoxy)benzene (PubChem CID 22186312) has the molecular formula C18H14Br8O2 and a molecular weight of 901.54 g/mol. Its IUPAC name is 1,3-dibromo-5-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]-2-(2,3-dibromopropoxy)benzene.
| Compound Name | 1,3-dibromo-5-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]-2-(2,3-dibromopropoxy)benzene |
|---|---|
| PubChem CID | 22186312 |
| Molecular Formula | C18H14Br8O2 |
| Molecular Weight | 901.54 g/mol |
| Exact Mass | 893.45 |
| IUPAC Name | 1,3-dibromo-5-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]-2-(2,3-dibromopropoxy)benzene |
| SMILES | BrCC(Br)COc1c(Br)cc(-c2cc(Br)c(OCC(Br)CBr)c(Br)c2)cc1Br |
| InChI | InChI=1S/C18H14Br8O2/c19-5-11(21)7-27-17-13(23)1-9(2-14(17)24)10-3-15(25)18(16(26)4-10)28-8-12(22)6-20/h1-4,11-12H,5-8H2 |
| InChIKey | WHPNROZQFIPAQO-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.54 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|