C18H15Br7O5S — CID 139784922
2-bromo-3-[2,6-dibromo-4-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]sulfonylphenoxy]propan-1-ol (PubChem CID 139784922) has the molecular formula C18H15Br7O5S and a molecular weight of 902.71 g/mol. Its IUPAC name is 2-bromo-3-[2,6-dibromo-4-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]sulfonylphenoxy]propan-1-ol.
| Compound Name | 2-bromo-3-[2,6-dibromo-4-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]sulfonylphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 139784922 |
| Molecular Formula | C18H15Br7O5S |
| Molecular Weight | 902.71 g/mol |
| Exact Mass | 895.49 |
| IUPAC Name | 2-bromo-3-[2,6-dibromo-4-[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]sulfonylphenoxy]propan-1-ol |
| SMILES | O=S(=O)(c1cc(Br)c(OCC(Br)CO)c(Br)c1)c1cc(Br)c(OCC(Br)CBr)c(Br)c1 |
| InChI | InChI=1S/C18H15Br7O5S/c19-5-9(20)7-29-17-13(22)1-11(2-14(17)23)31(27,28)12-3-15(24)18(16(25)4-12)30-8-10(21)6-26/h1-4,9-10,26H,5-8H2 |
| InChIKey | RIZXFQVZGPFAOD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|