C20H22Br4O8S — CID 139790389
2-[2-[2,6-dibromo-4-[3,5-dibromo-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfonylphenoxy]ethoxy]ethanol (PubChem CID 139790389) has the molecular formula C20H22Br4O8S and a molecular weight of 742.07 g/mol. Its IUPAC name is 2-[2-[2,6-dibromo-4-[3,5-dibromo-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfonylphenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2,6-dibromo-4-[3,5-dibromo-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfonylphenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 139790389 |
| Molecular Formula | C20H22Br4O8S |
| Molecular Weight | 742.07 g/mol |
| Exact Mass | 737.78 |
| IUPAC Name | 2-[2-[2,6-dibromo-4-[3,5-dibromo-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]sulfonylphenoxy]ethoxy]ethanol |
| SMILES | O=S(=O)(c1cc(Br)c(OCCOCCO)c(Br)c1)c1cc(Br)c(OCCOCCO)c(Br)c1 |
| InChI | InChI=1S/C20H22Br4O8S/c21-15-9-13(10-16(22)19(15)31-7-5-29-3-1-25)33(27,28)14-11-17(23)20(18(24)12-14)32-8-6-30-4-2-26/h9-12,25-26H,1-8H2 |
| InChIKey | JTSMJOCZBYQZPM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.07 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|