C14H21Br2NO3 — CID 107742869
2-[2-[2,6-dibromo-4-[(propan-2-ylamino)methyl]phenoxy]ethoxy]ethanol (PubChem CID 107742869) has the molecular formula C14H21Br2NO3 and a molecular weight of 411.13 g/mol. Its IUPAC name is 2-[2-[2,6-dibromo-4-[(propan-2-ylamino)methyl]phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2,6-dibromo-4-[(propan-2-ylamino)methyl]phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 107742869 |
| Molecular Formula | C14H21Br2NO3 |
| Molecular Weight | 411.13 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[2-[2,6-dibromo-4-[(propan-2-ylamino)methyl]phenoxy]ethoxy]ethanol |
| SMILES | CC(C)NCc1cc(Br)c(OCCOCCO)c(Br)c1 |
| InChI | InChI=1S/C14H21Br2NO3/c1-10(2)17-9-11-7-12(15)14(13(16)8-11)20-6-5-19-4-3-18/h7-8,10,17-18H,3-6,9H2,1-2H3 |
| InChIKey | HAOOTNHOGDAYIE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|