C14H19Br2NO — CID 107742720
N-[(3,5-dibromo-4-but-3-enoxyphenyl)methyl]propan-2-amine (PubChem CID 107742720) has the molecular formula C14H19Br2NO and a molecular weight of 377.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-but-3-enoxyphenyl)methyl]propan-2-amine.
| Compound Name | N-[(3,5-dibromo-4-but-3-enoxyphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107742720 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | N-[(3,5-dibromo-4-but-3-enoxyphenyl)methyl]propan-2-amine |
| SMILES | C=CCCOc1c(Br)cc(CNC(C)C)cc1Br |
| InChI | InChI=1S/C14H19Br2NO/c1-4-5-6-18-14-12(15)7-11(8-13(14)16)9-17-10(2)3/h4,7-8,10,17H,1,5-6,9H2,2-3H3 |
| InChIKey | LKROMRXLFMAGBY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|