C12H14Br4O — CID 20780618
1,3-dibromo-2-(2,3-dibromopropoxy)-5-propan-2-ylbenzene (PubChem CID 20780618) has the molecular formula C12H14Br4O and a molecular weight of 493.86 g/mol. Its IUPAC name is 1,3-dibromo-2-(2,3-dibromopropoxy)-5-propan-2-ylbenzene.
| Compound Name | 1,3-dibromo-2-(2,3-dibromopropoxy)-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 20780618 |
| Molecular Formula | C12H14Br4O |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 489.78 |
| IUPAC Name | 1,3-dibromo-2-(2,3-dibromopropoxy)-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(Br)c(OCC(Br)CBr)c(Br)c1 |
| InChI | InChI=1S/C12H14Br4O/c1-7(2)8-3-10(15)12(11(16)4-8)17-6-9(14)5-13/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | YZQIJWZZGFLWIB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|