C25H26Br6O4 — CID 139784880
1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]methyl]benzene (PubChem CID 139784880) has the molecular formula C25H26Br6O4 and a molecular weight of 869.90 g/mol. Its IUPAC name is 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]methyl]benzene.
| Compound Name | 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 139784880 |
| Molecular Formula | C25H26Br6O4 |
| Molecular Weight | 869.90 g/mol |
| Exact Mass | 863.69 |
| IUPAC Name | 1,3-dibromo-2-(3-bromo-2-prop-2-enoxypropoxy)-5-[[3,5-dibromo-4-(3-bromo-2-prop-2-enoxypropoxy)phenyl]methyl]benzene |
| SMILES | C=CCOC(CBr)COc1c(Br)cc(Cc2cc(Br)c(OCC(CBr)OCC=C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C25H26Br6O4/c1-3-5-32-18(12-26)14-34-24-20(28)8-16(9-21(24)29)7-17-10-22(30)25(23(31)11-17)35-15-19(13-27)33-6-4-2/h3-4,8-11,18-19H,1-2,5-7,12-15H2 |
| InChIKey | RMVSBMITRXGEDX-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.90 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|