C18H12Br6O4 — CID 23070524
1,3-bis(2,4,6-tribromophenoxy)propan-2-yl prop-2-enoate (PubChem CID 23070524) has the molecular formula C18H12Br6O4 and a molecular weight of 771.71 g/mol. Its IUPAC name is 1,3-bis(2,4,6-tribromophenoxy)propan-2-yl prop-2-enoate.
| Compound Name | 1,3-bis(2,4,6-tribromophenoxy)propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 23070524 |
| Molecular Formula | C18H12Br6O4 |
| Molecular Weight | 771.71 g/mol |
| Exact Mass | 765.58 |
| IUPAC Name | 1,3-bis(2,4,6-tribromophenoxy)propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(COc1c(Br)cc(Br)cc1Br)COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C18H12Br6O4/c1-2-16(25)28-11(7-26-17-12(21)3-9(19)4-13(17)22)8-27-18-14(23)5-10(20)6-15(18)24/h2-6,11H,1,7-8H2 |
| InChIKey | BWCGUOCSDMXYRG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|