C11H9Br3O3 — CID 139610668
prop-2-enyl 2-(2,4,6-tribromophenoxy)acetate (PubChem CID 139610668) has the molecular formula C11H9Br3O3 and a molecular weight of 428.90 g/mol. Its IUPAC name is prop-2-enyl 2-(2,4,6-tribromophenoxy)acetate.
| Compound Name | prop-2-enyl 2-(2,4,6-tribromophenoxy)acetate |
|---|---|
| PubChem CID | 139610668 |
| Molecular Formula | C11H9Br3O3 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 425.81 |
| IUPAC Name | prop-2-enyl 2-(2,4,6-tribromophenoxy)acetate |
| SMILES | C=CCOC(=O)COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H9Br3O3/c1-2-3-16-10(15)6-17-11-8(13)4-7(12)5-9(11)14/h2,4-5H,1,3,6H2 |
| InChIKey | LAWXRMCQBBSPIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|