C10H10Br3NO3 — CID 43509908
N-(2-hydroxyethyl)-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 43509908) has the molecular formula C10H10Br3NO3 and a molecular weight of 431.91 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 43509908 |
| Molecular Formula | C10H10Br3NO3 |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 428.82 |
| IUPAC Name | N-(2-hydroxyethyl)-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NCCO |
| InChI | InChI=1S/C10H10Br3NO3/c11-6-3-7(12)10(8(13)4-6)17-5-9(16)14-1-2-15/h3-4,15H,1-2,5H2,(H,14,16) |
| InChIKey | JMZQDTXZVFSSSB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |