C10H11BrFNO3 — CID 114675145
2-(5-bromo-2-fluorophenoxy)-N-(2-hydroxyethyl)acetamide (PubChem CID 114675145) has the molecular formula C10H11BrFNO3 and a molecular weight of 292.10 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenoxy)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(5-bromo-2-fluorophenoxy)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 114675145 |
| Molecular Formula | C10H11BrFNO3 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(5-bromo-2-fluorophenoxy)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(COc1cc(Br)ccc1F)NCCO |
| InChI | InChI=1S/C10H11BrFNO3/c11-7-1-2-8(12)9(5-7)16-6-10(15)13-3-4-14/h1-2,5,14H,3-4,6H2,(H,13,15) |
| InChIKey | RCRNXKCHTHCSLA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |