C11H11BrF3NO4 — CID 102714921
2-[3-bromo-4-(trifluoromethoxy)phenoxy]-N-(2-hydroxyethyl)acetamide (PubChem CID 102714921) has the molecular formula C11H11BrF3NO4 and a molecular weight of 358.11 g/mol. Its IUPAC name is 2-[3-bromo-4-(trifluoromethoxy)phenoxy]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[3-bromo-4-(trifluoromethoxy)phenoxy]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 102714921 |
| Molecular Formula | C11H11BrF3NO4 |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 2-[3-bromo-4-(trifluoromethoxy)phenoxy]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(COc1ccc(OC(F)(F)F)c(Br)c1)NCCO |
| InChI | InChI=1S/C11H11BrF3NO4/c12-8-5-7(19-6-10(18)16-3-4-17)1-2-9(8)20-11(13,14)15/h1-2,5,17H,3-4,6H2,(H,16,18) |
| InChIKey | RMEYDWKSOWWOAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |