C10H7Br5O — CID 152753476
1,3,5-tribromo-2-(2,3-dibromobut-2-enoxy)benzene (PubChem CID 152753476) has the molecular formula C10H7Br5O and a molecular weight of 542.69 g/mol. Its IUPAC name is 1,3,5-tribromo-2-(2,3-dibromobut-2-enoxy)benzene.
| Compound Name | 1,3,5-tribromo-2-(2,3-dibromobut-2-enoxy)benzene |
|---|---|
| PubChem CID | 152753476 |
| Molecular Formula | C10H7Br5O |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 537.64 |
| IUPAC Name | 1,3,5-tribromo-2-(2,3-dibromobut-2-enoxy)benzene |
| SMILES | CC(Br)=C(Br)COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C10H7Br5O/c1-5(11)9(15)4-16-10-7(13)2-6(12)3-8(10)14/h2-3H,4H2,1H3 |
| InChIKey | GMRDEZNLYZTSHK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |