C19H28Br2O3 — CID 159063312
6-(2,4-dibromo-6-propan-2-ylphenoxy)hexyl prop-2-enoate;methane (PubChem CID 159063312) has the molecular formula C19H28Br2O3 and a molecular weight of 464.24 g/mol. Its IUPAC name is 6-(2,4-dibromo-6-propan-2-ylphenoxy)hexyl prop-2-enoate;methane.
| Compound Name | 6-(2,4-dibromo-6-propan-2-ylphenoxy)hexyl prop-2-enoate;methane |
|---|---|
| PubChem CID | 159063312 |
| Molecular Formula | C19H28Br2O3 |
| Molecular Weight | 464.24 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 6-(2,4-dibromo-6-propan-2-ylphenoxy)hexyl prop-2-enoate;methane |
| SMILES | C.C=CC(=O)OCCCCCCOc1c(Br)cc(Br)cc1C(C)C |
| InChI | InChI=1S/C18H24Br2O3.CH4/c1-4-17(21)22-9-7-5-6-8-10-23-18-15(13(2)3)11-14(19)12-16(18)20;/h4,11-13H,1,5-10H2,2-3H3;1H4 |
| InChIKey | JYSXYXMYKPPAEU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.24 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|