C9H8Br5O2P — CID 70617209
1,3,5-tribromo-2-[1,2-dibromoethyl(methyl)phosphoryl]oxybenzene (PubChem CID 70617209) has the molecular formula C9H8Br5O2P and a molecular weight of 578.65 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[1,2-dibromoethyl(methyl)phosphoryl]oxybenzene.
| Compound Name | 1,3,5-tribromo-2-[1,2-dibromoethyl(methyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 70617209 |
| Molecular Formula | C9H8Br5O2P |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 573.62 |
| IUPAC Name | 1,3,5-tribromo-2-[1,2-dibromoethyl(methyl)phosphoryl]oxybenzene |
| SMILES | CP(=O)(Oc1c(Br)cc(Br)cc1Br)C(Br)CBr |
| InChI | InChI=1S/C9H8Br5O2P/c1-17(15,8(14)4-10)16-9-6(12)2-5(11)3-7(9)13/h2-3,8H,4H2,1H3 |
| InChIKey | FBVUPOBLOHFYRE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|