C11H11Br3O3 — CID 91619385
ethyl 2-bromo-2-(3,5-dibromo-2-methoxyphenyl)acetate (PubChem CID 91619385) has the molecular formula C11H11Br3O3 and a molecular weight of 430.92 g/mol. Its IUPAC name is ethyl 2-bromo-2-(3,5-dibromo-2-methoxyphenyl)acetate.
| Compound Name | ethyl 2-bromo-2-(3,5-dibromo-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 91619385 |
| Molecular Formula | C11H11Br3O3 |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 427.83 |
| IUPAC Name | ethyl 2-bromo-2-(3,5-dibromo-2-methoxyphenyl)acetate |
| SMILES | CCOC(=O)C(Br)c1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C11H11Br3O3/c1-3-17-11(15)9(14)7-4-6(12)5-8(13)10(7)16-2/h4-5,9H,3H2,1-2H3 |
| InChIKey | ARPNBAKYNGXFJW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|