C12H13Br3O2 — CID 70402954
1,3,5-tribromo-2-[1-(2-methylprop-2-enoxy)ethoxy]benzene (PubChem CID 70402954) has the molecular formula C12H13Br3O2 and a molecular weight of 428.95 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[1-(2-methylprop-2-enoxy)ethoxy]benzene.
| Compound Name | 1,3,5-tribromo-2-[1-(2-methylprop-2-enoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 70402954 |
| Molecular Formula | C12H13Br3O2 |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 425.85 |
| IUPAC Name | 1,3,5-tribromo-2-[1-(2-methylprop-2-enoxy)ethoxy]benzene |
| SMILES | C=C(C)COC(C)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H13Br3O2/c1-7(2)6-16-8(3)17-12-10(14)4-9(13)5-11(12)15/h4-5,8H,1,6H2,2-3H3 |
| InChIKey | IINAWZJADWWMRO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|