C24H44O8Si — CID 87063889
tetrakis[1-(2-methylprop-2-enoxy)ethyl] silicate (PubChem CID 87063889) has the molecular formula C24H44O8Si and a molecular weight of 488.69 g/mol. Its IUPAC name is tetrakis[1-(2-methylprop-2-enoxy)ethyl] silicate.
| Compound Name | tetrakis[1-(2-methylprop-2-enoxy)ethyl] silicate |
|---|---|
| PubChem CID | 87063889 |
| Molecular Formula | C24H44O8Si |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | tetrakis[1-(2-methylprop-2-enoxy)ethyl] silicate |
| SMILES | C=C(C)COC(C)O[Si](OC(C)OCC(=C)C)(OC(C)OCC(=C)C)OC(C)OCC(=C)C |
| InChI | InChI=1S/C24H44O8Si/c1-17(2)13-25-21(9)29-33(30-22(10)26-14-18(3)4,31-23(11)27-15-19(5)6)32-24(12)28-16-20(7)8/h21-24H,1,3,5,7,13-16H2,2,4,6,8-12H3 |
| InChIKey | FPOGWVGQPLQXBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|