About N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine
N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine (PubChem CID 71583350) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine |
| PubChem CID | 71583350 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine |
| SMILES | C=C(C)COC(OCC(=C)C)N(C)C |
| InChI | InChI=1S/C11H21NO2/c1-9(2)7-13-11(12(5)6)14-8-10(3)4/h11H,1,3,7-8H2,2,4-6H3 |
| InChIKey | ZJQNKHCKJYZRMB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine?
The IUPAC name of N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine (CID 71583350) is N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine.
What is the SMILES notation for N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine?
The canonical SMILES for N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine is C=C(C)COC(OCC(=C)C)N(C)C.
What is the InChIKey of N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine?
The InChIKey is ZJQNKHCKJYZRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-9(2)7-13-11(12(5)6)14-8-10(3)4/h11H,1,3,7-8H2,2,4-6H3.
What are the key properties of N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine?
N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine has a molecular weight of 199.29 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,1-bis(2-methylprop-2-enoxy)methanamine is sourced from PubChem (CID 71583350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).