C9H20FNO — CID 87225169
N,N-dimethylmethanamine;3-(1-fluoroethoxy)-2-methylprop-1-ene (PubChem CID 87225169) has the molecular formula C9H20FNO and a molecular weight of 177.26 g/mol. Its IUPAC name is N,N-dimethylmethanamine;3-(1-fluoroethoxy)-2-methylprop-1-ene.
| Compound Name | N,N-dimethylmethanamine;3-(1-fluoroethoxy)-2-methylprop-1-ene |
|---|---|
| PubChem CID | 87225169 |
| Molecular Formula | C9H20FNO |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N,N-dimethylmethanamine;3-(1-fluoroethoxy)-2-methylprop-1-ene |
| SMILES | C=C(C)COC(C)F.CN(C)C |
| InChI | InChI=1S/C6H11FO.C3H9N/c1-5(2)4-8-6(3)7;1-4(2)3/h6H,1,4H2,2-3H3;1-3H3 |
| InChIKey | WDLJPVAAAHRTET-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|