C11H19I3O2 — CID 88638538
1-iodo-2,2-bis(iodomethyl)-3-[1-(2-methylprop-2-enoxy)ethoxy]propane (PubChem CID 88638538) has the molecular formula C11H19I3O2 and a molecular weight of 563.98 g/mol. Its IUPAC name is 1-iodo-2,2-bis(iodomethyl)-3-[1-(2-methylprop-2-enoxy)ethoxy]propane.
| Compound Name | 1-iodo-2,2-bis(iodomethyl)-3-[1-(2-methylprop-2-enoxy)ethoxy]propane |
|---|---|
| PubChem CID | 88638538 |
| Molecular Formula | C11H19I3O2 |
| Molecular Weight | 563.98 g/mol |
| Exact Mass | 563.85 |
| IUPAC Name | 1-iodo-2,2-bis(iodomethyl)-3-[1-(2-methylprop-2-enoxy)ethoxy]propane |
| SMILES | C=C(C)COC(C)OCC(CI)(CI)CI |
| InChI | InChI=1S/C11H19I3O2/c1-9(2)4-15-10(3)16-8-11(5-12,6-13)7-14/h10H,1,4-8H2,2-3H3 |
| InChIKey | LAVKNAYPRMOTDU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|