C14H6Br6O2 — CID 138377093
1,3,5-tribromo-2-[1-(2,4,6-tribromophenoxy)ethenoxy]benzene (PubChem CID 138377093) has the molecular formula C14H6Br6O2 and a molecular weight of 685.62 g/mol. Its IUPAC name is 1,3,5-tribromo-2-[1-(2,4,6-tribromophenoxy)ethenoxy]benzene.
| Compound Name | 1,3,5-tribromo-2-[1-(2,4,6-tribromophenoxy)ethenoxy]benzene |
|---|---|
| PubChem CID | 138377093 |
| Molecular Formula | C14H6Br6O2 |
| Molecular Weight | 685.62 g/mol |
| Exact Mass | 679.55 |
| IUPAC Name | 1,3,5-tribromo-2-[1-(2,4,6-tribromophenoxy)ethenoxy]benzene |
| SMILES | C=C(Oc1c(Br)cc(Br)cc1Br)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H6Br6O2/c1-6(21-13-9(17)2-7(15)3-10(13)18)22-14-11(19)4-8(16)5-12(14)20/h2-5H,1H2 |
| InChIKey | GXUKYLWAEHDYSR-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|