C10H9F5O3S — CID 102621628
1-(2,5-difluoro-4-methylphenyl)ethyl trifluoromethanesulfonate (PubChem CID 102621628) has the molecular formula C10H9F5O3S and a molecular weight of 304.24 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methylphenyl)ethyl trifluoromethanesulfonate.
| Compound Name | 1-(2,5-difluoro-4-methylphenyl)ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102621628 |
| Molecular Formula | C10H9F5O3S |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 1-(2,5-difluoro-4-methylphenyl)ethyl trifluoromethanesulfonate |
| SMILES | Cc1cc(F)c(C(C)OS(=O)(=O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H9F5O3S/c1-5-3-9(12)7(4-8(5)11)6(2)18-19(16,17)10(13,14)15/h3-4,6H,1-2H3 |
| InChIKey | QWUPHGVMGCLVJB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|