C9H6F14O6S2 — CID 87127968
2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyloxy)propyl 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate (PubChem CID 87127968) has the molecular formula C9H6F14O6S2 and a molecular weight of 540.25 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyloxy)propyl 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyloxy)propyl 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 87127968 |
| Molecular Formula | C9H6F14O6S2 |
| Molecular Weight | 540.25 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfonyloxy)propyl 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
| SMILES | CC(COS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F)OS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F14O6S2/c1-3(29-31(26,27)5(11,8(18,19)20)9(21,22)23)2-28-30(24,25)4(10,6(12,13)14)7(15,16)17/h3H,2H2,1H3 |
| InChIKey | LDTOAUASMDSJBR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|