C15H14F18O6S2 — CID 21102766
2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)propyl 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate (PubChem CID 21102766) has the molecular formula C15H14F18O6S2 and a molecular weight of 696.37 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)propyl 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate.
| Compound Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)propyl 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 21102766 |
| Molecular Formula | C15H14F18O6S2 |
| Molecular Weight | 696.37 g/mol |
| Exact Mass | 695.99 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)propyl 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate |
| SMILES | CC(COS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F18O6S2/c1-7(39-41(36,37)5-3-9(18,19)11(22,23)13(26,27)15(31,32)33)6-38-40(34,35)4-2-8(16,17)10(20,21)12(24,25)14(28,29)30/h7H,2-6H2,1H3 |
| InChIKey | GZPJLALLSMIVTR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|