C24H20F34O8S2 — CID 87353760
butane-1,3-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-sulfonic acid) (PubChem CID 87353760) has the molecular formula C24H20F34O8S2 and a molecular weight of 1146.48 g/mol. Its IUPAC name is butane-1,3-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-sulfonic acid).
| Compound Name | butane-1,3-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87353760 |
| Molecular Formula | C24H20F34O8S2 |
| Molecular Weight | 1146.48 g/mol |
| Exact Mass | 1146.01 |
| IUPAC Name | butane-1,3-diol;bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-sulfonic acid) |
| SMILES | CC(O)CCO.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C10H5F17O3S.C4H10O2/c2*11-3(12,1-2-31(28,29)30)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27;1-4(6)2-3-5/h2*1-2H2,(H,28,29,30);4-6H,2-3H2,1H3 |
| InChIKey | ZKYJYMKGPBVAMX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.48 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|